C24H29NO6 — CID 135073015
2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-1-but-2-ynyl-5-phenyl-2-prop-2-enylpyrrolidine-2,3,4-tricarboxylate (PubChem CID 135073015) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-1-but-2-ynyl-5-phenyl-2-prop-2-enylpyrrolidine-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-1-but-2-ynyl-5-phenyl-2-prop-2-enylpyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 135073015 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-1-but-2-ynyl-5-phenyl-2-prop-2-enylpyrrolidine-2,3,4-tricarboxylate |
| SMILES | C=CC[C@]1(C(=O)OCC)[C@@H](C(=O)OC)[C@@H](C(=O)OC)[C@@H](c2ccccc2)N1CC#CC |
| InChI | InChI=1S/C24H29NO6/c1-6-9-16-25-20(17-13-11-10-12-14-17)18(21(26)29-4)19(22(27)30-5)24(25,15-7-2)23(28)31-8-3/h7,10-14,18-20H,2,8,15-16H2,1,3-5H3/t18-,19-,20-,24-/m1/s1 |
| InChIKey | ZNZFNZFRVWDLOV-DBYOASNMSA-N |
| XLogP | 2.52 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|