C33H50O5SSi — CID 135078189
[6-methylsulfanyl-7-(naphthalen-2-ylmethoxy)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-8-yl]oxy-tri(propan-2-yl)silane (PubChem CID 135078189) has the molecular formula C33H50O5SSi and a molecular weight of 586.91 g/mol. Its IUPAC name is [6-methylsulfanyl-7-(naphthalen-2-ylmethoxy)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-8-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [6-methylsulfanyl-7-(naphthalen-2-ylmethoxy)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-8-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135078189 |
| Molecular Formula | C33H50O5SSi |
| Molecular Weight | 586.91 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | [6-methylsulfanyl-7-(naphthalen-2-ylmethoxy)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-8-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CSC1OC2COC3(CCCCC3)OC2C(O[Si](C(C)C)(C(C)C)C(C)C)C1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H50O5SSi/c1-22(2)40(23(3)4,24(5)6)38-30-29-28(21-35-33(37-29)17-11-8-12-18-33)36-32(39-7)31(30)34-20-25-15-16-26-13-9-10-14-27(26)19-25/h9-10,13-16,19,22-24,28-32H,8,11-12,17-18,20-21H2,1-7H3 |
| InChIKey | XCYKDISRJDYKNU-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.91 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|