C39H34INO5S — CID 11961728
(2S,4aR,6R,7S,8S,8aR)-2-[(2-iodophenyl)methyl]-8-(naphthalen-2-ylmethoxy)-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile (PubChem CID 11961728) has the molecular formula C39H34INO5S and a molecular weight of 755.67 g/mol. Its IUPAC name is (2S,4aR,6R,7S,8S,8aR)-2-[(2-iodophenyl)methyl]-8-(naphthalen-2-ylmethoxy)-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile.
| Compound Name | (2S,4aR,6R,7S,8S,8aR)-2-[(2-iodophenyl)methyl]-8-(naphthalen-2-ylmethoxy)-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile |
|---|---|
| PubChem CID | 11961728 |
| Molecular Formula | C39H34INO5S |
| Molecular Weight | 755.67 g/mol |
| Exact Mass | 755.12 |
| IUPAC Name | (2S,4aR,6R,7S,8S,8aR)-2-[(2-iodophenyl)methyl]-8-(naphthalen-2-ylmethoxy)-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile |
| SMILES | N#C[C@@]1(Cc2ccccc2I)OC[C@H]2O[C@H](Sc3ccccc3)[C@@H](OCc3ccccc3)[C@@H](OCc3ccc4ccccc4c3)[C@@H]2O1 |
| InChI | InChI=1S/C39H34INO5S/c40-33-18-10-9-15-31(33)22-39(26-41)44-25-34-35(46-39)36(42-24-28-19-20-29-13-7-8-14-30(29)21-28)37(43-23-27-11-3-1-4-12-27)38(45-34)47-32-16-5-2-6-17-32/h1-21,34-38H,22-25H2/t34-,35-,36+,37+,38-,39+/m1/s1 |
| InChIKey | MCWNGCTZUSKRKY-GACMIMLXSA-N |
| XLogP | 8.31 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.67 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|