C28H25IN4O4S — CID 16742319
(2S,4aR,6R,7S,8S,8aS)-8-azido-2-[(2-iodophenyl)methyl]-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile (PubChem CID 16742319) has the molecular formula C28H25IN4O4S and a molecular weight of 640.50 g/mol. Its IUPAC name is (2S,4aR,6R,7S,8S,8aS)-8-azido-2-[(2-iodophenyl)methyl]-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile.
| Compound Name | (2S,4aR,6R,7S,8S,8aS)-8-azido-2-[(2-iodophenyl)methyl]-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile |
|---|---|
| PubChem CID | 16742319 |
| Molecular Formula | C28H25IN4O4S |
| Molecular Weight | 640.50 g/mol |
| Exact Mass | 640.06 |
| IUPAC Name | (2S,4aR,6R,7S,8S,8aS)-8-azido-2-[(2-iodophenyl)methyl]-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile |
| SMILES | N#C[C@@]1(Cc2ccccc2I)OC[C@H]2O[C@H](Sc3ccccc3)[C@@H](OCc3ccccc3)[C@@H](N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C28H25IN4O4S/c29-22-14-8-7-11-20(22)15-28(18-30)35-17-23-25(37-28)24(32-33-31)26(34-16-19-9-3-1-4-10-19)27(36-23)38-21-12-5-2-6-13-21/h1-14,23-27H,15-17H2/t23-,24+,25-,26+,27-,28+/m1/s1 |
| InChIKey | GGBGKPQZRLEOOZ-JABWBWSPSA-N |
| XLogP | 6.25 |
| TPSA | 109.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|