C28H32INO6 — CID 11961729
(2S,4aR,6R,7S,8S,8aS)-6-cyclohexyloxy-8-hydroxy-2-[(2-iodophenyl)methyl]-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile (PubChem CID 11961729) has the molecular formula C28H32INO6 and a molecular weight of 605.47 g/mol. Its IUPAC name is (2S,4aR,6R,7S,8S,8aS)-6-cyclohexyloxy-8-hydroxy-2-[(2-iodophenyl)methyl]-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile.
| Compound Name | (2S,4aR,6R,7S,8S,8aS)-6-cyclohexyloxy-8-hydroxy-2-[(2-iodophenyl)methyl]-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile |
|---|---|
| PubChem CID | 11961729 |
| Molecular Formula | C28H32INO6 |
| Molecular Weight | 605.47 g/mol |
| Exact Mass | 605.13 |
| IUPAC Name | (2S,4aR,6R,7S,8S,8aS)-6-cyclohexyloxy-8-hydroxy-2-[(2-iodophenyl)methyl]-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile |
| SMILES | N#C[C@@]1(Cc2ccccc2I)OC[C@H]2O[C@@H](OC3CCCCC3)[C@@H](OCc3ccccc3)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C28H32INO6/c29-22-14-8-7-11-20(22)15-28(18-30)33-17-23-25(36-28)24(31)26(32-16-19-9-3-1-4-10-19)27(35-23)34-21-12-5-2-6-13-21/h1,3-4,7-11,14,21,23-27,31H,2,5-6,12-13,15-17H2/t23-,24+,25-,26+,27-,28+/m1/s1 |
| InChIKey | WGTILZFUWPVYQT-JABWBWSPSA-N |
| XLogP | 4.49 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|