C21H19IN4O4S — CID 16742246
(2S,4aR,6R,7S,8R,8aS)-8-azido-7-hydroxy-2-[(2-iodophenyl)methyl]-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile (PubChem CID 16742246) has the molecular formula C21H19IN4O4S and a molecular weight of 550.38 g/mol. Its IUPAC name is (2S,4aR,6R,7S,8R,8aS)-8-azido-7-hydroxy-2-[(2-iodophenyl)methyl]-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile.
| Compound Name | (2S,4aR,6R,7S,8R,8aS)-8-azido-7-hydroxy-2-[(2-iodophenyl)methyl]-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile |
|---|---|
| PubChem CID | 16742246 |
| Molecular Formula | C21H19IN4O4S |
| Molecular Weight | 550.38 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | (2S,4aR,6R,7S,8R,8aS)-8-azido-7-hydroxy-2-[(2-iodophenyl)methyl]-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2-carbonitrile |
| SMILES | N#C[C@@]1(Cc2ccccc2I)OC[C@H]2O[C@H](Sc3ccccc3)[C@@H](O)[C@@H](N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C21H19IN4O4S/c22-15-9-5-4-6-13(15)10-21(12-23)28-11-16-19(30-21)17(25-26-24)18(27)20(29-16)31-14-7-2-1-3-8-14/h1-9,16-20,27H,10-11H2/t16-,17-,18+,19-,20-,21+/m1/s1 |
| InChIKey | NLESENBCZXBXNC-RZTRGMPVSA-N |
| XLogP | 4.03 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|