C18H24F3NO — CID 135078715
[(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-(3-methylbutyl)ethanimidate (PubChem CID 135078715) has the molecular formula C18H24F3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is [(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-(3-methylbutyl)ethanimidate.
| Compound Name | [(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-(3-methylbutyl)ethanimidate |
|---|---|
| PubChem CID | 135078715 |
| Molecular Formula | C18H24F3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | [(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-(3-methylbutyl)ethanimidate |
| SMILES | CC(C)CC/N=C(/OC/C=C/CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO/c1-15(2)12-13-22-17(18(19,20)21)23-14-8-4-7-11-16-9-5-3-6-10-16/h3-6,8-10,15H,7,11-14H2,1-2H3/b8-4+,22-17+ |
| InChIKey | JENKQDIBVBYUNA-YZSNMBILSA-N |
| XLogP | 5.20 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|