C20H28F3NO — CID 135078800
[(E)-3-methyl-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-hexylethanimidate (PubChem CID 135078800) has the molecular formula C20H28F3NO and a molecular weight of 355.44 g/mol. Its IUPAC name is [(E)-3-methyl-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-hexylethanimidate.
| Compound Name | [(E)-3-methyl-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-hexylethanimidate |
|---|---|
| PubChem CID | 135078800 |
| Molecular Formula | C20H28F3NO |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [(E)-3-methyl-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-hexylethanimidate |
| SMILES | CCCCCC/N=C(/OC/C=C(\C)CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H28F3NO/c1-3-4-5-9-15-24-19(20(21,22)23)25-16-14-17(2)12-13-18-10-7-6-8-11-18/h6-8,10-11,14H,3-5,9,12-13,15-16H2,1-2H3/b17-14+,24-19+ |
| InChIKey | YMQSXOFCFUYPNY-GHNFOOBMSA-N |
| XLogP | 6.12 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|