C20H30F3NO2Si — CID 135079010
[(Z)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate (PubChem CID 135079010) has the molecular formula C20H30F3NO2Si and a molecular weight of 401.55 g/mol. Its IUPAC name is [(Z)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate.
| Compound Name | [(Z)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
|---|---|
| PubChem CID | 135079010 |
| Molecular Formula | C20H30F3NO2Si |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [(Z)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C\CO/C(=N\CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H30F3NO2Si/c1-19(2,3)27(4,5)26-16-10-9-15-25-18(20(21,22)23)24-14-13-17-11-7-6-8-12-17/h6-12H,13-16H2,1-5H3/b10-9-,24-18- |
| InChIKey | YOASFZGTMQSXAR-YDAGOXPZSA-N |
| XLogP | 5.78 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|