C15H18F3NO — CID 139250961
[(E)-pent-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate (PubChem CID 139250961) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is [(E)-pent-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate.
| Compound Name | [(E)-pent-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
|---|---|
| PubChem CID | 139250961 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | [(E)-pent-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
| SMILES | C/C=C/C(C)O/C(=N\CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO/c1-3-7-12(2)20-14(15(16,17)18)19-11-10-13-8-5-4-6-9-13/h3-9,12H,10-11H2,1-2H3/b7-3+,19-14- |
| InChIKey | FAYDJQAWNKSLHW-NIABYXRXSA-N |
| XLogP | 4.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|