C14H16F3NO — CID 135079880
[(E)-but-2-enyl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate (PubChem CID 135079880) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate.
| Compound Name | [(E)-but-2-enyl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
|---|---|
| PubChem CID | 135079880 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | [(E)-but-2-enyl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
| SMILES | C/C=C/CO/C(=N\CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO/c1-2-3-11-19-13(14(15,16)17)18-10-9-12-7-5-4-6-8-12/h2-8H,9-11H2,1H3/b3-2+,18-13- |
| InChIKey | YRFZJDCYLGNBCG-IFDSIBPQSA-N |
| XLogP | 3.78 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|