C19H26F3NO — CID 135079973
[(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-hexylethanimidate (PubChem CID 135079973) has the molecular formula C19H26F3NO and a molecular weight of 341.42 g/mol. Its IUPAC name is [(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-hexylethanimidate.
| Compound Name | [(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-hexylethanimidate |
|---|---|
| PubChem CID | 135079973 |
| Molecular Formula | C19H26F3NO |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [(E)-5-phenylpent-2-enyl] 2,2,2-trifluoro-N-hexylethanimidate |
| SMILES | CCCCCC/N=C(/OC/C=C/CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H26F3NO/c1-2-3-4-10-15-23-18(19(20,21)22)24-16-11-6-9-14-17-12-7-5-8-13-17/h5-8,11-13H,2-4,9-10,14-16H2,1H3/b11-6+,23-18+ |
| InChIKey | MQEZFGKOJPHIQB-PYNHJNMHSA-N |
| XLogP | 5.73 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|