C49H49BF4O3Si — CID 135078736
[(1R,2R)-1-naphthalen-2-yl-2-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]but-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 135078736) has the molecular formula C49H49BF4O3Si and a molecular weight of 800.82 g/mol. Its IUPAC name is [(1R,2R)-1-naphthalen-2-yl-2-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]but-3-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(1R,2R)-1-naphthalen-2-yl-2-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]but-3-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135078736 |
| Molecular Formula | C49H49BF4O3Si |
| Molecular Weight | 800.82 g/mol |
| Exact Mass | 800.35 |
| IUPAC Name | [(1R,2R)-1-naphthalen-2-yl-2-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]but-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | C=C[C@@H](B1OC(c2ccc(F)cc2)(c2ccc(F)cc2)C(c2ccc(F)cc2)(c2ccc(F)cc2)O1)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C49H49BF4O3Si/c1-8-46(47(55-58(32(2)3,33(4)5)34(6)7)37-14-13-35-11-9-10-12-36(35)31-37)50-56-48(38-15-23-42(51)24-16-38,39-17-25-43(52)26-18-39)49(57-50,40-19-27-44(53)28-20-40)41-21-29-45(54)30-22-41/h8-34,46-47H,1H2,2-7H3/t46-,47+/m1/s1 |
| InChIKey | CWZJGOJTGSOMJT-ZYIRWWKFSA-N |
| XLogP | 13.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.82 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|