C7H12O — CID 135079327
(Z,1R)-1-cyclopropylbut-2-en-1-ol (PubChem CID 135079327) has the molecular formula C7H12O and a molecular weight of 112.17 g/mol. Its IUPAC name is (Z,1R)-1-cyclopropylbut-2-en-1-ol.
| Compound Name | (Z,1R)-1-cyclopropylbut-2-en-1-ol |
|---|---|
| PubChem CID | 135079327 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | (Z,1R)-1-cyclopropylbut-2-en-1-ol |
| SMILES | C/C=C\[C@H](O)C1CC1 |
| InChI | InChI=1S/C7H12O/c1-2-3-7(8)6-4-5-6/h2-3,6-8H,4-5H2,1H3/b3-2-/t7-/m0/s1 |
| InChIKey | KFLPUIOCUICVPT-XDVGHUOJSA-N |
| XLogP | 1.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|