C28H32BNO2 — CID 135082748
(3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methoxyphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 135082748) has the molecular formula C28H32BNO2 and a molecular weight of 425.38 g/mol. Its IUPAC name is (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methoxyphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methoxyphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 135082748 |
| Molecular Formula | C28H32BNO2 |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methoxyphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | COc1ccccc1B1OC(c2cc(C)cc(C)c2)(c2cc(C)cc(C)c2)[C@@H]2CCCN12 |
| InChI | InChI=1S/C28H32BNO2/c1-19-13-20(2)16-23(15-19)28(24-17-21(3)14-22(4)18-24)27-11-8-12-30(27)29(32-28)25-9-6-7-10-26(25)31-5/h6-7,9-10,13-18,27H,8,11-12H2,1-5H3/t27-/m0/s1 |
| InChIKey | HMFWPJNWVLXUQV-MHZLTWQESA-N |
| XLogP | 5.06 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|