C28H32BNO — CID 72827762
3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 72827762) has the molecular formula C28H32BNO and a molecular weight of 409.38 g/mol. Its IUPAC name is 3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | 3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 72827762 |
| Molecular Formula | C28H32BNO |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | Cc1cc(C)cc(C2(c3cc(C)cc(C)c3)OB(c3ccccc3C)N3CCCC32)c1 |
| InChI | InChI=1S/C28H32BNO/c1-19-13-20(2)16-24(15-19)28(25-17-21(3)14-22(4)18-25)27-11-8-12-30(27)29(31-28)26-10-7-6-9-23(26)5/h6-7,9-10,13-18,27H,8,11-12H2,1-5H3 |
| InChIKey | LYTFKTJBOMUAIR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|