C43H32AuF3N2P2S — CID 135083203
gold(1+);1,3,5-trifluorobenzene-6-ide;[triphenyl-[(triphenyl-λ5-phosphanylidene)amino]-λ5-phosphanyl] thiocyanate (PubChem CID 135083203) has the molecular formula C43H32AuF3N2P2S and a molecular weight of 924.72 g/mol. Its IUPAC name is gold(1+);1,3,5-trifluorobenzene-6-ide;[triphenyl-[(triphenyl-λ5-phosphanylidene)amino]-λ5-phosphanyl] thiocyanate.
| Compound Name | gold(1+);1,3,5-trifluorobenzene-6-ide;[triphenyl-[(triphenyl-λ5-phosphanylidene)amino]-λ5-phosphanyl] thiocyanate |
|---|---|
| PubChem CID | 135083203 |
| Molecular Formula | C43H32AuF3N2P2S |
| Molecular Weight | 924.72 g/mol |
| Exact Mass | 924.14 |
| IUPAC Name | gold(1+);1,3,5-trifluorobenzene-6-ide;[triphenyl-[(triphenyl-λ5-phosphanylidene)amino]-λ5-phosphanyl] thiocyanate |
| SMILES | Fc1[c-]c(F)cc(F)c1.N#CSP(N=P(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1.[Au+] |
| InChI | InChI=1S/C37H30N2P2S.C6H2F3.Au/c38-31-42-41(35-25-13-4-14-26-35,36-27-15-5-16-28-36,37-29-17-6-18-30-37)39-40(32-19-7-1-8-20-32,33-21-9-2-10-22-33)34-23-11-3-12-24-34;7-4-1-5(8)3-6(9)2-4;/h1-30H;1-2H;/q;-1;+1 |
| InChIKey | HFSLZZUPFYDHAG-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.72 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|