About 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium
1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium (PubChem CID 135085366) has the molecular formula C26H31I2N2PPd
and a molecular weight of 762.75 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium.
Molecular Properties
| Compound Name | 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium |
| PubChem CID | 135085366 |
| Molecular Formula | C26H31I2N2PPd |
| Molecular Weight | 762.75 g/mol |
| Exact Mass | 761.93 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium |
| SMILES | CCCCN1C=CN(C)[CH-]1.I[Pd]I.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C8H15N2.2HI.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-4-5-10-7-6-9(2)8-10;;;/h1-15H;6-8H,3-5H2,1-2H3;2*1H;/q;-1;;;+2/p-1 |
| InChIKey | OIXVRKDVBWUMDI-UHFFFAOYSA-M |
| XLogP | 6.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 762.75 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium?
The IUPAC name of 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium (CID 135085366) is 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium.
What is the SMILES notation for 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium?
The canonical SMILES for 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium is CCCCN1C=CN(C)[CH-]1.I[Pd]I.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium?
The InChIKey is OIXVRKDVBWUMDI-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15P.C8H15N2.2HI.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-4-5-10-7-6-9(2)8-10;;;/h1-15H;6-8H,3-5H2,1-2H3;2*1H;/q;-1;;;+2/p-1.
What are the key properties of 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium?
1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium has a molecular weight of 762.75 g/mol, XLogP of 6.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methyl-2H-imidazol-2-ide;diiodopalladium;triphenylphosphanium is sourced from PubChem (CID 135085366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).