C18H23N3O — CID 135086551
2-(4-hexyltriazol-1-yl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 135086551) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-(4-hexyltriazol-1-yl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-(4-hexyltriazol-1-yl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 135086551 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2-(4-hexyltriazol-1-yl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CCCCCCc1cn(C2CCc3ccccc3C2=O)nn1 |
| InChI | InChI=1S/C18H23N3O/c1-2-3-4-5-9-15-13-21(20-19-15)17-12-11-14-8-6-7-10-16(14)18(17)22/h6-8,10,13,17H,2-5,9,11-12H2,1H3 |
| InChIKey | MPEKUNZKIQZVSM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|