C16H17F4N3O2 — CID 135104084
N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 135104084) has the molecular formula C16H17F4N3O2 and a molecular weight of 359.32 g/mol. Its IUPAC name is N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 135104084 |
| Molecular Formula | C16H17F4N3O2 |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | Cc1c(C(C)NC(=O)c2ccccc2OC(F)(F)C(F)F)cnn1C |
| InChI | InChI=1S/C16H17F4N3O2/c1-9(12-8-21-23(3)10(12)2)22-14(24)11-6-4-5-7-13(11)25-16(19,20)15(17)18/h4-9,15H,1-3H3,(H,22,24) |
| InChIKey | QXHZKUGQOZBTBC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|