C18H22N2O5S — CID 135109689
3-methyl-6-[(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)sulfonyl]-1,3-benzoxazol-2-one (PubChem CID 135109689) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-methyl-6-[(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)sulfonyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-6-[(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)sulfonyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 135109689 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3-methyl-6-[(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)sulfonyl]-1,3-benzoxazol-2-one |
| SMILES | CC1=CC2(CCN(S(=O)(=O)c3ccc4c(c3)oc(=O)n4C)CC2)OCC1 |
| InChI | InChI=1S/C18H22N2O5S/c1-13-5-10-24-18(12-13)6-8-20(9-7-18)26(22,23)14-3-4-15-16(11-14)25-17(21)19(15)2/h3-4,11-12H,5-10H2,1-2H3 |
| InChIKey | RVOJWMMLEJVNLD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|