C24H27N3O3 — CID 135114158
2-(3-butanoylindol-1-yl)-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide (PubChem CID 135114158) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-(3-butanoylindol-1-yl)-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide.
| Compound Name | 2-(3-butanoylindol-1-yl)-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 135114158 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-(3-butanoylindol-1-yl)-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide |
| SMILES | CCCC(=O)c1cn(CC(=O)N[C@@H]2COC[C@H]2Cc2ccncc2)c2ccccc12 |
| InChI | InChI=1S/C24H27N3O3/c1-2-5-23(28)20-13-27(22-7-4-3-6-19(20)22)14-24(29)26-21-16-30-15-18(21)12-17-8-10-25-11-9-17/h3-4,6-11,13,18,21H,2,5,12,14-16H2,1H3,(H,26,29)/t18-,21-/m1/s1 |
| InChIKey | LEWZVPHIWKNZRG-WIYYLYMNSA-N |
| XLogP | 3.39 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |