C23H34N4O2 — CID 135118546
N-[[(1S,5S,6R,7R)-3-[(2,6,6-trimethylcyclohexen-1-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1H-pyrazole-4-carboxamide (PubChem CID 135118546) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(2,6,6-trimethylcyclohexen-1-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(2,6,6-trimethylcyclohexen-1-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 135118546 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(2,6,6-trimethylcyclohexen-1-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1H-pyrazole-4-carboxamide |
| SMILES | CC1=C(CN2C[C@@H]3[C@H](CNC(=O)c4cn[nH]c4)[C@H]4CC[C@]3(C2)O4)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H34N4O2/c1-15-5-4-7-22(2,3)18(15)12-27-13-19-17(20-6-8-23(19,14-27)29-20)11-24-21(28)16-9-25-26-10-16/h9-10,17,19-20H,4-8,11-14H2,1-3H3,(H,24,28)(H,25,26)/t17-,19+,20+,23+/m0/s1 |
| InChIKey | RDNAKQRODSQAFB-JEBQKTDQSA-N |
| XLogP | 3.15 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|