C9H7N3O7 — CID 135127101
3-(4-hydroxy-3,5-dinitrophenyl)-2-iminopropanoic acid (PubChem CID 135127101) has the molecular formula C9H7N3O7 and a molecular weight of 269.17 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dinitrophenyl)-2-iminopropanoic acid.
| Compound Name | 3-(4-hydroxy-3,5-dinitrophenyl)-2-iminopropanoic acid |
|---|---|
| PubChem CID | 135127101 |
| Molecular Formula | C9H7N3O7 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 3-(4-hydroxy-3,5-dinitrophenyl)-2-iminopropanoic acid |
| SMILES | [H]/N=C(/Cc1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C9H7N3O7/c10-5(9(14)15)1-4-2-6(11(16)17)8(13)7(3-4)12(18)19/h2-3,10,13H,1H2,(H,14,15)/b10-5- |
| InChIKey | XNEJQBCVNKQMOZ-YHYXMXQVSA-N |
| XLogP | 0.86 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|