C11H13N3O4 — CID 135150943
(2R)-2-amino-2-(2-amino-2-oxoethyl)-3-oxo-4-pyridin-4-ylbutanoic acid (PubChem CID 135150943) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is (2R)-2-amino-2-(2-amino-2-oxoethyl)-3-oxo-4-pyridin-4-ylbutanoic acid.
| Compound Name | (2R)-2-amino-2-(2-amino-2-oxoethyl)-3-oxo-4-pyridin-4-ylbutanoic acid |
|---|---|
| PubChem CID | 135150943 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (2R)-2-amino-2-(2-amino-2-oxoethyl)-3-oxo-4-pyridin-4-ylbutanoic acid |
| SMILES | NC(=O)C[C@](N)(C(=O)O)C(=O)Cc1ccncc1 |
| InChI | InChI=1S/C11H13N3O4/c12-9(16)6-11(13,10(17)18)8(15)5-7-1-3-14-4-2-7/h1-4H,5-6,13H2,(H2,12,16)(H,17,18)/t11-/m1/s1 |
| InChIKey | ZQCSHPNFQCZPOC-LLVKDONJSA-N |
| XLogP | -1.15 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|