About butan-2-ylazanium formate
butan-2-ylazanium formate (PubChem CID 135151120) has the molecular formula C5H13NO2
and a molecular weight of 119.16 g/mol. Its IUPAC name is butan-2-ylazanium formate.
Molecular Properties
| Compound Name | butan-2-ylazanium formate |
| PubChem CID | 135151120 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | butan-2-ylazanium formate |
| SMILES | CCC(C)[NH3+].O=C[O-] |
| InChI | InChI=1S/C4H11N.CH2O2/c1-3-4(2)5;2-1-3/h4H,3,5H2,1-2H3;1H,(H,2,3) |
| InChIKey | YVCJIELDVOOGCW-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylazanium formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylazanium formate?
The IUPAC name of butan-2-ylazanium formate (CID 135151120) is butan-2-ylazanium formate.
What is the SMILES notation for butan-2-ylazanium formate?
The canonical SMILES for butan-2-ylazanium formate is CCC(C)[NH3+].O=C[O-].
What is the InChIKey of butan-2-ylazanium formate?
The InChIKey is YVCJIELDVOOGCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.CH2O2/c1-3-4(2)5;2-1-3/h4H,3,5H2,1-2H3;1H,(H,2,3).
What are the key properties of butan-2-ylazanium formate?
butan-2-ylazanium formate has a molecular weight of 119.16 g/mol, XLogP of -1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylazanium formate is sourced from PubChem (CID 135151120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).