C7H18N+ — CID 36688718
[(2R,4S)-4-methylhexan-2-yl]azanium (PubChem CID 36688718) has the molecular formula C7H18N+ and a molecular weight of 116.23 g/mol. Its IUPAC name is [(2R,4S)-4-methylhexan-2-yl]azanium.
| Compound Name | [(2R,4S)-4-methylhexan-2-yl]azanium |
|---|---|
| PubChem CID | 36688718 |
| Molecular Formula | C7H18N+ |
| Molecular Weight | 116.23 g/mol |
| Exact Mass | 116.14 |
| IUPAC Name | [(2R,4S)-4-methylhexan-2-yl]azanium |
| SMILES | CC[C@H](C)C[C@@H](C)[NH3+] |
| InChI | InChI=1S/C7H17N/c1-4-6(2)5-7(3)8/h6-7H,4-5,8H2,1-3H3/p+1/t6-,7+/m0/s1 |
| InChIKey | YAHRDLICUYEDAU-NKWVEPMBSA-O |
| XLogP | 1.05 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |