About 2-methylbutylazanium formate
2-methylbutylazanium formate (PubChem CID 134716580) has the molecular formula C6H15NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-methylbutylazanium formate.
Molecular Properties
| Compound Name | 2-methylbutylazanium formate |
| PubChem CID | 134716580 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 2-methylbutylazanium formate |
| SMILES | CCC(C)C[NH3+].O=C[O-] |
| InChI | InChI=1S/C5H13N.CH2O2/c1-3-5(2)4-6;2-1-3/h5H,3-4,6H2,1-2H3;1H,(H,2,3) |
| InChIKey | IMHQOJNGVJBABJ-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutylazanium formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutylazanium formate?
The IUPAC name of 2-methylbutylazanium formate (CID 134716580) is 2-methylbutylazanium formate.
What is the SMILES notation for 2-methylbutylazanium formate?
The canonical SMILES for 2-methylbutylazanium formate is CCC(C)C[NH3+].O=C[O-].
What is the InChIKey of 2-methylbutylazanium formate?
The InChIKey is IMHQOJNGVJBABJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.CH2O2/c1-3-5(2)4-6;2-1-3/h5H,3-4,6H2,1-2H3;1H,(H,2,3).
What are the key properties of 2-methylbutylazanium formate?
2-methylbutylazanium formate has a molecular weight of 133.19 g/mol, XLogP of -1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutylazanium formate is sourced from PubChem (CID 134716580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).