About chlorosulfonylmethyl 2,2-dimethylpropanoate
chlorosulfonylmethyl 2,2-dimethylpropanoate (PubChem CID 135151279) has the molecular formula C6H11ClO4S
and a molecular weight of 214.67 g/mol. Its IUPAC name is chlorosulfonylmethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | chlorosulfonylmethyl 2,2-dimethylpropanoate |
| PubChem CID | 135151279 |
| Molecular Formula | C6H11ClO4S |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | chlorosulfonylmethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCS(=O)(=O)Cl |
| InChI | InChI=1S/C6H11ClO4S/c1-6(2,3)5(8)11-4-12(7,9)10/h4H2,1-3H3 |
| InChIKey | KQNYEWJYYFQEFI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze chlorosulfonylmethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosulfonylmethyl 2,2-dimethylpropanoate?
The IUPAC name of chlorosulfonylmethyl 2,2-dimethylpropanoate (CID 135151279) is chlorosulfonylmethyl 2,2-dimethylpropanoate.
What is the SMILES notation for chlorosulfonylmethyl 2,2-dimethylpropanoate?
The canonical SMILES for chlorosulfonylmethyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCS(=O)(=O)Cl.
What is the InChIKey of chlorosulfonylmethyl 2,2-dimethylpropanoate?
The InChIKey is KQNYEWJYYFQEFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO4S/c1-6(2,3)5(8)11-4-12(7,9)10/h4H2,1-3H3.
What are the key properties of chlorosulfonylmethyl 2,2-dimethylpropanoate?
chlorosulfonylmethyl 2,2-dimethylpropanoate has a molecular weight of 214.67 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosulfonylmethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 135151279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).