C6H11ClO3S — CID 115021593
3,3-dimethyl-2-oxobutane-1-sulfonyl chloride (PubChem CID 115021593) has the molecular formula C6H11ClO3S and a molecular weight of 198.67 g/mol. Its IUPAC name is 3,3-dimethyl-2-oxobutane-1-sulfonyl chloride.
| Compound Name | 3,3-dimethyl-2-oxobutane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 115021593 |
| Molecular Formula | C6H11ClO3S |
| Molecular Weight | 198.67 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 3,3-dimethyl-2-oxobutane-1-sulfonyl chloride |
| SMILES | CC(C)(C)C(=O)CS(=O)(=O)Cl |
| InChI | InChI=1S/C6H11ClO3S/c1-6(2,3)5(8)4-11(7,9)10/h4H2,1-3H3 |
| InChIKey | DTFHGBXKQQYFKI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.67 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |