C7H12F2O3S — CID 58435949
1-(difluoromethylsulfonyl)-3,3-dimethylbutan-2-one (PubChem CID 58435949) has the molecular formula C7H12F2O3S and a molecular weight of 214.23 g/mol. Its IUPAC name is 1-(difluoromethylsulfonyl)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(difluoromethylsulfonyl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 58435949 |
| Molecular Formula | C7H12F2O3S |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1-(difluoromethylsulfonyl)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CS(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H12F2O3S/c1-7(2,3)5(10)4-13(11,12)6(8)9/h6H,4H2,1-3H3 |
| InChIKey | JNVLVKCFBOZRSF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |