C34H39N5O5 — CID 135151558
1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]-N'-(naphthalene-2-carbonyl)-4-(4-oxohexyl)piperazine-2-carbohydrazide (PubChem CID 135151558) has the molecular formula C34H39N5O5 and a molecular weight of 597.72 g/mol. Its IUPAC name is 1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]-N'-(naphthalene-2-carbonyl)-4-(4-oxohexyl)piperazine-2-carbohydrazide.
| Compound Name | 1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]-N'-(naphthalene-2-carbonyl)-4-(4-oxohexyl)piperazine-2-carbohydrazide |
|---|---|
| PubChem CID | 135151558 |
| Molecular Formula | C34H39N5O5 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | 1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]-N'-(naphthalene-2-carbonyl)-4-(4-oxohexyl)piperazine-2-carbohydrazide |
| SMILES | CCC(=O)CCCN1CCN(C(=O)Cc2c(C)[nH]c3ccc(OC)cc23)C(C(=O)NNC(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C34H39N5O5/c1-4-26(40)10-7-15-38-16-17-39(32(41)20-28-22(2)35-30-14-13-27(44-3)19-29(28)30)31(21-38)34(43)37-36-33(42)25-12-11-23-8-5-6-9-24(23)18-25/h5-6,8-9,11-14,18-19,31,35H,4,7,10,15-17,20-21H2,1-3H3,(H,36,42)(H,37,43) |
| InChIKey | GKOUMVKXIQSYHP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|