C9H18N2O4 — CID 135156035
tert-butyl N-[[(2S)-1-methoxy-3-oxopropan-2-yl]amino]carbamate (PubChem CID 135156035) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-1-methoxy-3-oxopropan-2-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2S)-1-methoxy-3-oxopropan-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 135156035 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | tert-butyl N-[[(2S)-1-methoxy-3-oxopropan-2-yl]amino]carbamate |
| SMILES | COC[C@@H](C=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18N2O4/c1-9(2,3)15-8(13)11-10-7(5-12)6-14-4/h5,7,10H,6H2,1-4H3,(H,11,13)/t7-/m1/s1 |
| InChIKey | UIYJNWJGOQHWGJ-SSDOTTSWSA-N |
| XLogP | 0.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|