C14H20F3N3O4 — CID 135169207
1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-methoxy-4-oxoazetidine-1,2-dicarboxamide (PubChem CID 135169207) has the molecular formula C14H20F3N3O4 and a molecular weight of 351.33 g/mol. Its IUPAC name is 1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-methoxy-4-oxoazetidine-1,2-dicarboxamide.
| Compound Name | 1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-methoxy-4-oxoazetidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 135169207 |
| Molecular Formula | C14H20F3N3O4 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-methoxy-4-oxoazetidine-1,2-dicarboxamide |
| SMILES | CONC(=O)C1CC(=O)N1C(=O)NC(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H20F3N3O4/c1-24-19-12(22)9-7-10(21)20(9)13(23)18-11(14(15,16)17)8-5-3-2-4-6-8/h8-9,11H,2-7H2,1H3,(H,18,23)(H,19,22) |
| InChIKey | KIEALPRMGNKUQR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|