C20H16Cl2N2O5 — CID 135180147
N-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-oxopyrano[2,3-c]pyridin-6-yl]methyl]prop-2-enamide (PubChem CID 135180147) has the molecular formula C20H16Cl2N2O5 and a molecular weight of 435.26 g/mol. Its IUPAC name is N-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-oxopyrano[2,3-c]pyridin-6-yl]methyl]prop-2-enamide.
| Compound Name | N-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-oxopyrano[2,3-c]pyridin-6-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 135180147 |
| Molecular Formula | C20H16Cl2N2O5 |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-oxopyrano[2,3-c]pyridin-6-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc2c(=O)cc(-c3c(Cl)c(OC)cc(OC)c3Cl)oc2cn1 |
| InChI | InChI=1S/C20H16Cl2N2O5/c1-4-17(26)24-8-10-5-11-12(25)6-13(29-16(11)9-23-10)18-19(21)14(27-2)7-15(28-3)20(18)22/h4-7,9H,1,8H2,2-3H3,(H,24,26) |
| InChIKey | CXEKYUZFTFTZLH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|