C22H21Cl2N3O6 — CID 167095650
N-[3-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-oxopyrano[2,3-c]pyridin-6-yl]amino]oxan-4-yl]formamide (PubChem CID 167095650) has the molecular formula C22H21Cl2N3O6 and a molecular weight of 494.33 g/mol. Its IUPAC name is N-[3-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-oxopyrano[2,3-c]pyridin-6-yl]amino]oxan-4-yl]formamide.
| Compound Name | N-[3-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-oxopyrano[2,3-c]pyridin-6-yl]amino]oxan-4-yl]formamide |
|---|---|
| PubChem CID | 167095650 |
| Molecular Formula | C22H21Cl2N3O6 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | N-[3-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-oxopyrano[2,3-c]pyridin-6-yl]amino]oxan-4-yl]formamide |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc(=O)c3cc(NC4COCCC4NC=O)ncc3o2)c1Cl |
| InChI | InChI=1S/C22H21Cl2N3O6/c1-30-16-7-17(31-2)22(24)20(21(16)23)15-6-14(29)11-5-19(25-8-18(11)33-15)27-13-9-32-4-3-12(13)26-10-28/h5-8,10,12-13H,3-4,9H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | CBLHOOJYHUMGCJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|