C14H15F3O5 — CID 135182654
2-[(2-methylpropan-2-yl)oxy]-2-[(2,3,4-trifluorophenyl)methyl]propanedioic acid (PubChem CID 135182654) has the molecular formula C14H15F3O5 and a molecular weight of 320.26 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]-2-[(2,3,4-trifluorophenyl)methyl]propanedioic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]-2-[(2,3,4-trifluorophenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 135182654 |
| Molecular Formula | C14H15F3O5 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]-2-[(2,3,4-trifluorophenyl)methyl]propanedioic acid |
| SMILES | CC(C)(C)OC(Cc1ccc(F)c(F)c1F)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H15F3O5/c1-13(2,3)22-14(11(18)19,12(20)21)6-7-4-5-8(15)10(17)9(7)16/h4-5H,6H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | OCLOUJAYYKOIKY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|