C17H23N — CID 135190908
(2Z,4Z,8Z,10Z)-N,N-dimethyl-6-methylidenetetradeca-2,4,8,10-tetraen-13-yn-1-amine (PubChem CID 135190908) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (2Z,4Z,8Z,10Z)-N,N-dimethyl-6-methylidenetetradeca-2,4,8,10-tetraen-13-yn-1-amine.
| Compound Name | (2Z,4Z,8Z,10Z)-N,N-dimethyl-6-methylidenetetradeca-2,4,8,10-tetraen-13-yn-1-amine |
|---|---|
| PubChem CID | 135190908 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (2Z,4Z,8Z,10Z)-N,N-dimethyl-6-methylidenetetradeca-2,4,8,10-tetraen-13-yn-1-amine |
| SMILES | C#CC/C=C\C=C/CC(=C)/C=C\C=C/CN(C)C |
| InChI | InChI=1S/C17H23N/c1-5-6-7-8-9-11-14-17(2)15-12-10-13-16-18(3)4/h1,7-13,15H,2,6,14,16H2,3-4H3/b8-7-,11-9-,13-10-,15-12- |
| InChIKey | SSPDAXNDIDWYGG-RTCQAVDZSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|