C19H29FN4O5S — CID 135197979
1-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]sulfamoylamino]butyl]-2-hydroxyimidazolidin-4-one (PubChem CID 135197979) has the molecular formula C19H29FN4O5S and a molecular weight of 444.53 g/mol. Its IUPAC name is 1-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]sulfamoylamino]butyl]-2-hydroxyimidazolidin-4-one.
| Compound Name | 1-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]sulfamoylamino]butyl]-2-hydroxyimidazolidin-4-one |
|---|---|
| PubChem CID | 135197979 |
| Molecular Formula | C19H29FN4O5S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]sulfamoylamino]butyl]-2-hydroxyimidazolidin-4-one |
| SMILES | C[C@@H](NS(=O)(=O)NCCCCN1CC(=O)NC1O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C19H29FN4O5S/c1-13(15-6-7-16(20)17(10-15)29-12-14-4-5-14)23-30(27,28)21-8-2-3-9-24-11-18(25)22-19(24)26/h6-7,10,13-14,19,21,23,26H,2-5,8-9,11-12H2,1H3,(H,22,25)/t13-,19?/m1/s1 |
| InChIKey | ZLSOIKHLCJVPTK-BSOCMFCZSA-N |
| XLogP | 0.59 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|