C17H29ClN4O3S — CID 135198522
tert-butyl N-[2-[4-(3-amino-4-chlorocyclohexa-1,5-dien-1-yl)piperazin-1-yl]sulfinylethyl]carbamate (PubChem CID 135198522) has the molecular formula C17H29ClN4O3S and a molecular weight of 404.96 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(3-amino-4-chlorocyclohexa-1,5-dien-1-yl)piperazin-1-yl]sulfinylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(3-amino-4-chlorocyclohexa-1,5-dien-1-yl)piperazin-1-yl]sulfinylethyl]carbamate |
|---|---|
| PubChem CID | 135198522 |
| Molecular Formula | C17H29ClN4O3S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | tert-butyl N-[2-[4-(3-amino-4-chlorocyclohexa-1,5-dien-1-yl)piperazin-1-yl]sulfinylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCS(=O)N1CCN(C2=CC(N)C(Cl)C=C2)CC1 |
| InChI | InChI=1S/C17H29ClN4O3S/c1-17(2,3)25-16(23)20-6-11-26(24)22-9-7-21(8-10-22)13-4-5-14(18)15(19)12-13/h4-5,12,14-15H,6-11,19H2,1-3H3,(H,20,23) |
| InChIKey | RDHJKFZRKCPTCC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|