C21H18ClN3O3 — CID 135203459
1-[(6-chloro-3-pyridinyl)methyl]-8-(3,5-dimethyl-1,2-oxazol-4-yl)-7-methoxyquinolin-2-one (PubChem CID 135203459) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-8-(3,5-dimethyl-1,2-oxazol-4-yl)-7-methoxyquinolin-2-one.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-8-(3,5-dimethyl-1,2-oxazol-4-yl)-7-methoxyquinolin-2-one |
|---|---|
| PubChem CID | 135203459 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-8-(3,5-dimethyl-1,2-oxazol-4-yl)-7-methoxyquinolin-2-one |
| SMILES | COc1ccc2ccc(=O)n(Cc3ccc(Cl)nc3)c2c1-c1c(C)noc1C |
| InChI | InChI=1S/C21H18ClN3O3/c1-12-19(13(2)28-24-12)20-16(27-3)7-5-15-6-9-18(26)25(21(15)20)11-14-4-8-17(22)23-10-14/h4-10H,11H2,1-3H3 |
| InChIKey | IPZGGJCGMFNURT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|