C14H14ClN5O3 — CID 118589452
4-[(6-chloro-3-pyridinyl)methyl]-2-(methoxymethoxy)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 118589452) has the molecular formula C14H14ClN5O3 and a molecular weight of 335.75 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-2-(methoxymethoxy)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-2-(methoxymethoxy)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 118589452 |
| Molecular Formula | C14H14ClN5O3 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-2-(methoxymethoxy)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | COCOc1nc2n(Cc3ccc(Cl)nc3)c(C)cc(=O)n2n1 |
| InChI | InChI=1S/C14H14ClN5O3/c1-9-5-12(21)20-14(17-13(18-20)23-8-22-2)19(9)7-10-3-4-11(15)16-6-10/h3-6H,7-8H2,1-2H3 |
| InChIKey | OXYXXDMEGLXUIM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|