C15H17ClN6O2 — CID 118594592
4-[(6-chloro-3-pyridinyl)methyl]-2-[methoxymethyl(methyl)amino]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 118594592) has the molecular formula C15H17ClN6O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-2-[methoxymethyl(methyl)amino]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-2-[methoxymethyl(methyl)amino]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 118594592 |
| Molecular Formula | C15H17ClN6O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-2-[methoxymethyl(methyl)amino]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | COCN(C)c1nc2n(Cc3ccc(Cl)nc3)c(C)cc(=O)n2n1 |
| InChI | InChI=1S/C15H17ClN6O2/c1-10-6-13(23)22-15(18-14(19-22)20(2)9-24-3)21(10)8-11-4-5-12(16)17-7-11/h4-7H,8-9H2,1-3H3 |
| InChIKey | SIIPWAHCALVFPW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|