C19H14ClN5O4 — CID 118594868
4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-2-(4-nitrophenoxy)pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 118594868) has the molecular formula C19H14ClN5O4 and a molecular weight of 411.81 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-2-(4-nitrophenoxy)pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-2-(4-nitrophenoxy)pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 118594868 |
| Molecular Formula | C19H14ClN5O4 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-2-(4-nitrophenoxy)pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n2nc(Oc3ccc([N+](=O)[O-])cc3)cc2n1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H14ClN5O4/c1-12-8-19(26)24-18(23(12)11-13-2-7-16(20)21-10-13)9-17(22-24)29-15-5-3-14(4-6-15)25(27)28/h2-10H,11H2,1H3 |
| InChIKey | GLXRMJYIDAGWPP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|