C14H12ClN5O3 — CID 118594640
[4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-7-oxo-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl] acetate (PubChem CID 118594640) has the molecular formula C14H12ClN5O3 and a molecular weight of 333.74 g/mol. Its IUPAC name is [4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-7-oxo-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl] acetate.
| Compound Name | [4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-7-oxo-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl] acetate |
|---|---|
| PubChem CID | 118594640 |
| Molecular Formula | C14H12ClN5O3 |
| Molecular Weight | 333.74 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | [4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-7-oxo-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl] acetate |
| SMILES | CC(=O)Oc1nc2n(Cc3ccc(Cl)nc3)c(C)cc(=O)n2n1 |
| InChI | InChI=1S/C14H12ClN5O3/c1-8-5-12(22)20-14(17-13(18-20)23-9(2)21)19(8)7-10-3-4-11(15)16-6-10/h3-6H,7H2,1-2H3 |
| InChIKey | OOAZVIROQAYJFT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.74 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|