About 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one
2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 118594877) has the molecular formula C17H19ClN4O3S
and a molecular weight of 394.88 g/mol. Its IUPAC name is 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 118594877 |
| Molecular Formula | C17H19ClN4O3S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCC(C)S(=O)(=O)c1cc2n(Cc3ccc(Cl)nc3)c(C)cc(=O)n2n1 |
| InChI | InChI=1S/C17H19ClN4O3S/c1-4-12(3)26(24,25)15-8-16-21(10-13-5-6-14(18)19-9-13)11(2)7-17(23)22(16)20-15/h5-9,12H,4,10H2,1-3H3 |
| InChIKey | ANNCHRATTGDAOY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one (CID 118594877) is 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one is CCC(C)S(=O)(=O)c1cc2n(Cc3ccc(Cl)nc3)c(C)cc(=O)n2n1.
What is the InChIKey of 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is ANNCHRATTGDAOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN4O3S/c1-4-12(3)26(24,25)15-8-16-21(10-13-5-6-14(18)19-9-13)11(2)7-17(23)22(16)20-15/h5-9,12H,4,10H2,1-3H3.
What are the key properties of 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one?
2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 394.88 g/mol, XLogP of 2.47, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 118594877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).