C17H19ClN4O3S — CID 118594877
2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 118594877) has the molecular formula C17H19ClN4O3S and a molecular weight of 394.88 g/mol. Its IUPAC name is 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 118594877 |
| Molecular Formula | C17H19ClN4O3S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-butan-2-ylsulfonyl-4-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCC(C)S(=O)(=O)c1cc2n(Cc3ccc(Cl)nc3)c(C)cc(=O)n2n1 |
| InChI | InChI=1S/C17H19ClN4O3S/c1-4-12(3)26(24,25)15-8-16-21(10-13-5-6-14(18)19-9-13)11(2)7-17(23)22(16)20-15/h5-9,12H,4,10H2,1-3H3 |
| InChIKey | ANNCHRATTGDAOY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|