C15H14Cl2N4O2S — CID 118594789
4-[(4,6-dichloro-3-pyridinyl)methyl]-2-ethylsulfinyl-5-methylpyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 118594789) has the molecular formula C15H14Cl2N4O2S and a molecular weight of 385.28 g/mol. Its IUPAC name is 4-[(4,6-dichloro-3-pyridinyl)methyl]-2-ethylsulfinyl-5-methylpyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 4-[(4,6-dichloro-3-pyridinyl)methyl]-2-ethylsulfinyl-5-methylpyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 118594789 |
| Molecular Formula | C15H14Cl2N4O2S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 4-[(4,6-dichloro-3-pyridinyl)methyl]-2-ethylsulfinyl-5-methylpyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCS(=O)c1cc2n(Cc3cnc(Cl)cc3Cl)c(C)cc(=O)n2n1 |
| InChI | InChI=1S/C15H14Cl2N4O2S/c1-3-24(23)13-6-14-20(9(2)4-15(22)21(14)19-13)8-10-7-18-12(17)5-11(10)16/h4-7H,3,8H2,1-2H3 |
| InChIKey | HPVPVPOJLSSLSQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|