C15H15ClN4OS — CID 118594770
4-[(6-chloro-3-pyridinyl)methyl]-5-ethyl-2-methylsulfanylpyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 118594770) has the molecular formula C15H15ClN4OS and a molecular weight of 334.83 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-5-ethyl-2-methylsulfanylpyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-5-ethyl-2-methylsulfanylpyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 118594770 |
| Molecular Formula | C15H15ClN4OS |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-5-ethyl-2-methylsulfanylpyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCc1cc(=O)n2nc(SC)cc2n1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H15ClN4OS/c1-3-11-6-15(21)20-14(7-13(18-20)22-2)19(11)9-10-4-5-12(16)17-8-10/h4-8H,3,9H2,1-2H3 |
| InChIKey | RRWMIFMAVXLBMD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|