C12H11ClN6O — CID 118596098
4-[(6-chloro-3-pyridinyl)methyl]-5,6-dimethyltetrazolo[1,5-a]pyrimidin-7-one (PubChem CID 118596098) has the molecular formula C12H11ClN6O and a molecular weight of 290.71 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-5,6-dimethyltetrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-5,6-dimethyltetrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 118596098 |
| Molecular Formula | C12H11ClN6O |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-5,6-dimethyltetrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1c(C)n(Cc2ccc(Cl)nc2)c2nnnn2c1=O |
| InChI | InChI=1S/C12H11ClN6O/c1-7-8(2)18(6-9-3-4-10(13)14-5-9)12-15-16-17-19(12)11(7)20/h3-5H,6H2,1-2H3 |
| InChIKey | JUHQZJAESDRSKG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|