C19H17ClN6OS — CID 123921806
4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-2-methylsulfanyl-N-phenoxy-[1,2,4]triazolo[1,5-a]pyrimidin-7-imine (PubChem CID 123921806) has the molecular formula C19H17ClN6OS and a molecular weight of 412.91 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-2-methylsulfanyl-N-phenoxy-[1,2,4]triazolo[1,5-a]pyrimidin-7-imine.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-2-methylsulfanyl-N-phenoxy-[1,2,4]triazolo[1,5-a]pyrimidin-7-imine |
|---|---|
| PubChem CID | 123921806 |
| Molecular Formula | C19H17ClN6OS |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-5-methyl-2-methylsulfanyl-N-phenoxy-[1,2,4]triazolo[1,5-a]pyrimidin-7-imine |
| SMILES | CSc1nc2n(Cc3ccc(Cl)nc3)c(C)cc(=NOc3ccccc3)n2n1 |
| InChI | InChI=1S/C19H17ClN6OS/c1-13-10-17(24-27-15-6-4-3-5-7-15)26-19(22-18(23-26)28-2)25(13)12-14-8-9-16(20)21-11-14/h3-11H,12H2,1-2H3 |
| InChIKey | KLNDTCPYRYYOPF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|